--- mp3togo/conf.py

+++ mp3togo/conf.py

@@ -137,6 +137,7 @@ class Options(options.Options):

self.bin['mpg321'] = False

self.bin['ogg123'] = False

self.bin['flac'] = False

+ self.bin['faad'] = False

self.bin['metaflac'] = False

self.bin['normalize-audio'] = False

self.bin['dcop'] = False

@@ -152,7 +153,7 @@ Description:

mp3 player or an mp3 CD. The files to convert can be

specified in a playlist file (m3u, pls and plain text are

supported) or given as arguments to the program. mp3togo

- will go through the list and run mpg321, ogg123, flac and

+ will go through the list and run mpg321, ogg123, flac, faad and

lame to decode and reencode the files. The newly encoded

files will be written to the destination directory. The

software can retain as much of the subdirectory structure

@@ -238,7 +239,7 @@ def getfiletype(filename):

"""Return the format of an audio file"""

# Could use some more magic here

ft = os.path.splitext(filename)[1][1:]

- if ft not in ('mp3', 'ogg', 'flac', 'wav'):

+ if ft not in ('mp3', 'ogg', 'flac', 'wav', 'm4a'):

raise ErrorUnknownFileType

return ft